About N'-acetyl-4-formyl-N'-phenylbenzohydrazide
N'-acetyl-4-formyl-N'-phenylbenzohydrazide (PubChem CID 166611175) has the molecular formula C16H14N2O3
and a molecular weight of 282.30 g/mol. Its IUPAC name is N'-acetyl-4-formyl-N'-phenylbenzohydrazide.
Molecular Properties
| Compound Name | N'-acetyl-4-formyl-N'-phenylbenzohydrazide |
| PubChem CID | 166611175 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | N'-acetyl-4-formyl-N'-phenylbenzohydrazide |
| SMILES | CC(=O)N(NC(=O)c1ccc(C=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C16H14N2O3/c1-12(20)18(15-5-3-2-4-6-15)17-16(21)14-9-7-13(11-19)8-10-14/h2-11H,1H3,(H,17,21) |
| InChIKey | MUTXYWLMNJAVDN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-acetyl-4-formyl-N'-phenylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-acetyl-4-formyl-N'-phenylbenzohydrazide?
The IUPAC name of N'-acetyl-4-formyl-N'-phenylbenzohydrazide (CID 166611175) is N'-acetyl-4-formyl-N'-phenylbenzohydrazide.
What is the SMILES notation for N'-acetyl-4-formyl-N'-phenylbenzohydrazide?
The canonical SMILES for N'-acetyl-4-formyl-N'-phenylbenzohydrazide is CC(=O)N(NC(=O)c1ccc(C=O)cc1)c1ccccc1.
What is the InChIKey of N'-acetyl-4-formyl-N'-phenylbenzohydrazide?
The InChIKey is MUTXYWLMNJAVDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O3/c1-12(20)18(15-5-3-2-4-6-15)17-16(21)14-9-7-13(11-19)8-10-14/h2-11H,1H3,(H,17,21).
What are the key properties of N'-acetyl-4-formyl-N'-phenylbenzohydrazide?
N'-acetyl-4-formyl-N'-phenylbenzohydrazide has a molecular weight of 282.30 g/mol, XLogP of 2.20, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-acetyl-4-formyl-N'-phenylbenzohydrazide is sourced from PubChem (CID 166611175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).