C28H28N4O2S — CID 166611292
(E)-3-(4-butoxyphenyl)-2-[5-[(E)-2-(4-butoxyphenyl)-1-cyanoethenyl]-1,2,4-thiadiazol-3-yl]prop-2-enenitrile (PubChem CID 166611292) has the molecular formula C28H28N4O2S and a molecular weight of 484.63 g/mol. Its IUPAC name is (E)-3-(4-butoxyphenyl)-2-[5-[(E)-2-(4-butoxyphenyl)-1-cyanoethenyl]-1,2,4-thiadiazol-3-yl]prop-2-enenitrile.
| Compound Name | (E)-3-(4-butoxyphenyl)-2-[5-[(E)-2-(4-butoxyphenyl)-1-cyanoethenyl]-1,2,4-thiadiazol-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 166611292 |
| Molecular Formula | C28H28N4O2S |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | (E)-3-(4-butoxyphenyl)-2-[5-[(E)-2-(4-butoxyphenyl)-1-cyanoethenyl]-1,2,4-thiadiazol-3-yl]prop-2-enenitrile |
| SMILES | CCCCOc1ccc(/C=C(\C#N)c2nsc(/C(C#N)=C/c3ccc(OCCCC)cc3)n2)cc1 |
| InChI | InChI=1S/C28H28N4O2S/c1-3-5-15-33-25-11-7-21(8-12-25)17-23(19-29)27-31-28(35-32-27)24(20-30)18-22-9-13-26(14-10-22)34-16-6-4-2/h7-14,17-18H,3-6,15-16H2,1-2H3/b23-17+,24-18+ |
| InChIKey | TULLXJIBEVVNNI-GJHDBBOXSA-N |
| XLogP | 7.02 |
| TPSA | 91.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|