C25H36O4 — CID 166627072
5,7-dihydroxy-6-methyl-2-[(Z)-pentadec-10-enyl]chromen-4-one (PubChem CID 166627072) has the molecular formula C25H36O4 and a molecular weight of 400.56 g/mol. Its IUPAC name is 5,7-dihydroxy-6-methyl-2-[(Z)-pentadec-10-enyl]chromen-4-one.
| Compound Name | 5,7-dihydroxy-6-methyl-2-[(Z)-pentadec-10-enyl]chromen-4-one |
|---|---|
| PubChem CID | 166627072 |
| Molecular Formula | C25H36O4 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 5,7-dihydroxy-6-methyl-2-[(Z)-pentadec-10-enyl]chromen-4-one |
| SMILES | CCCC/C=C\CCCCCCCCCc1cc(=O)c2c(O)c(C)c(O)cc2o1 |
| InChI | InChI=1S/C25H36O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20-17-22(27)24-23(29-20)18-21(26)19(2)25(24)28/h6-7,17-18,26,28H,3-5,8-16H2,1-2H3/b7-6- |
| InChIKey | JQUCMTMSYVVJCA-SREVYHEPSA-N |
| XLogP | 6.92 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|