C24H34O4 — CID 166634856
5,7-dihydroxy-2-[(Z)-pentadec-10-enyl]chromen-4-one (PubChem CID 166634856) has the molecular formula C24H34O4 and a molecular weight of 386.53 g/mol. Its IUPAC name is 5,7-dihydroxy-2-[(Z)-pentadec-10-enyl]chromen-4-one.
| Compound Name | 5,7-dihydroxy-2-[(Z)-pentadec-10-enyl]chromen-4-one |
|---|---|
| PubChem CID | 166634856 |
| Molecular Formula | C24H34O4 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | 5,7-dihydroxy-2-[(Z)-pentadec-10-enyl]chromen-4-one |
| SMILES | CCCC/C=C\CCCCCCCCCc1cc(=O)c2c(O)cc(O)cc2o1 |
| InChI | InChI=1S/C24H34O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-20-18-22(27)24-21(26)16-19(25)17-23(24)28-20/h5-6,16-18,25-26H,2-4,7-15H2,1H3/b6-5- |
| InChIKey | CUNLEFFHJFMUOH-WAYWQWQTSA-N |
| XLogP | 6.61 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|