C30H26FN7O6S — CID 16663563
1-[4-[2-(3,4-dimethoxyphenyl)ethylcarbamothioylamino]-6-(2-oxochromen-4-yl)oxy-1,3,5-triazin-2-yl]-3-(4-fluorophenyl)urea (PubChem CID 16663563) has the molecular formula C30H26FN7O6S and a molecular weight of 631.65 g/mol. Its IUPAC name is 1-[4-[2-(3,4-dimethoxyphenyl)ethylcarbamothioylamino]-6-(2-oxochromen-4-yl)oxy-1,3,5-triazin-2-yl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[4-[2-(3,4-dimethoxyphenyl)ethylcarbamothioylamino]-6-(2-oxochromen-4-yl)oxy-1,3,5-triazin-2-yl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 16663563 |
| Molecular Formula | C30H26FN7O6S |
| Molecular Weight | 631.65 g/mol |
| Exact Mass | 631.16 |
| IUPAC Name | 1-[4-[2-(3,4-dimethoxyphenyl)ethylcarbamothioylamino]-6-(2-oxochromen-4-yl)oxy-1,3,5-triazin-2-yl]-3-(4-fluorophenyl)urea |
| SMILES | COc1ccc(CCNC(=S)Nc2nc(NC(=O)Nc3ccc(F)cc3)nc(Oc3cc(=O)oc4ccccc34)n2)cc1OC |
| InChI | InChI=1S/C30H26FN7O6S/c1-41-22-12-7-17(15-24(22)42-2)13-14-32-30(45)38-27-34-26(35-28(40)33-19-10-8-18(31)9-11-19)36-29(37-27)44-23-16-25(39)43-21-6-4-3-5-20(21)23/h3-12,15-16H,13-14H2,1-2H3,(H4,32,33,34,35,36,37,38,40,45) |
| InChIKey | ILZNOZSZYLLGFB-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 161.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.65 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|