C30H26ClN7O5S2 — CID 16663335
1-(2-chlorophenyl)-3-[4-[2-(3,4-dimethoxyphenyl)ethylcarbamothioylamino]-6-(2-oxochromen-4-yl)oxy-1,3,5-triazin-2-yl]thiourea (PubChem CID 16663335) has the molecular formula C30H26ClN7O5S2 and a molecular weight of 664.17 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[4-[2-(3,4-dimethoxyphenyl)ethylcarbamothioylamino]-6-(2-oxochromen-4-yl)oxy-1,3,5-triazin-2-yl]thiourea.
| Compound Name | 1-(2-chlorophenyl)-3-[4-[2-(3,4-dimethoxyphenyl)ethylcarbamothioylamino]-6-(2-oxochromen-4-yl)oxy-1,3,5-triazin-2-yl]thiourea |
|---|---|
| PubChem CID | 16663335 |
| Molecular Formula | C30H26ClN7O5S2 |
| Molecular Weight | 664.17 g/mol |
| Exact Mass | 663.11 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[4-[2-(3,4-dimethoxyphenyl)ethylcarbamothioylamino]-6-(2-oxochromen-4-yl)oxy-1,3,5-triazin-2-yl]thiourea |
| SMILES | COc1ccc(CCNC(=S)Nc2nc(NC(=S)Nc3ccccc3Cl)nc(Oc3cc(=O)oc4ccccc34)n2)cc1OC |
| InChI | InChI=1S/C30H26ClN7O5S2/c1-40-22-12-11-17(15-24(22)41-2)13-14-32-29(44)37-26-34-27(38-30(45)33-20-9-5-4-8-19(20)31)36-28(35-26)43-23-16-25(39)42-21-10-6-3-7-18(21)23/h3-12,15-16H,13-14H2,1-2H3,(H4,32,33,34,35,36,37,38,44,45) |
| InChIKey | KGHVALBABBZPEK-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 144.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.17 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|