C51H48N3O15P3 — CID 166637626
4-[[4,6-bis(4-carboxyphenoxy)-2,4,6-tris(2-methoxy-4-prop-2-enylphenoxy)-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-trien-2-yl]oxy]benzoic acid (PubChem CID 166637626) has the molecular formula C51H48N3O15P3 and a molecular weight of 1035.87 g/mol. Its IUPAC name is 4-[[4,6-bis(4-carboxyphenoxy)-2,4,6-tris(2-methoxy-4-prop-2-enylphenoxy)-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-trien-2-yl]oxy]benzoic acid.
| Compound Name | 4-[[4,6-bis(4-carboxyphenoxy)-2,4,6-tris(2-methoxy-4-prop-2-enylphenoxy)-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-trien-2-yl]oxy]benzoic acid |
|---|---|
| PubChem CID | 166637626 |
| Molecular Formula | C51H48N3O15P3 |
| Molecular Weight | 1035.87 g/mol |
| Exact Mass | 1035.23 |
| IUPAC Name | 4-[[4,6-bis(4-carboxyphenoxy)-2,4,6-tris(2-methoxy-4-prop-2-enylphenoxy)-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-trien-2-yl]oxy]benzoic acid |
| SMILES | C=CCc1ccc(OP2(Oc3ccc(C(=O)O)cc3)=NP(Oc3ccc(C(=O)O)cc3)(Oc3ccc(CC=C)cc3OC)=NP(Oc3ccc(C(=O)O)cc3)(Oc3ccc(CC=C)cc3OC)=N2)c(OC)c1 |
| InChI | InChI=1S/C51H48N3O15P3/c1-7-10-34-13-28-43(46(31-34)61-4)67-70(64-40-22-16-37(17-23-40)49(55)56)52-71(65-41-24-18-38(19-25-41)50(57)58,68-44-29-14-35(11-8-2)32-47(44)62-5)54-72(53-70,66-42-26-20-39(21-27-42)51(59)60)69-45-30-15-36(12-9-3)33-48(45)63-6/h7-9,13-33H,1-3,10-12H2,4-6H3,(H,55,56)(H,57,58)(H,59,60) |
| InChIKey | YIRGZMMVKRBMKA-UHFFFAOYSA-N |
| XLogP | 13.62 |
| TPSA | 232.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1035.87 |
| LogP ≤ 5 | 13.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|