About CID 166639295
CID 166639295 (PubChem CID 166639295) has the molecular formula C23H26OP2+
and a molecular weight of 380.41 g/mol.
Molecular Properties
| Compound Name | CID 166639295 |
| PubChem CID | 166639295 |
| Molecular Formula | C23H26OP2+ |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | — |
| SMILES | C[C@@H]([C]1[CH][CH][CH][C]1[P+](=O)C(C)(C)C)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H26OP2/c1-18(21-16-11-17-22(21)26(24)23(2,3)4)25(19-12-7-5-8-13-19)20-14-9-6-10-15-20/h5-18H,1-4H3/q+1/t18-/m0/s1 |
| InChIKey | CUZHJOIDDRCKKU-SFHVURJKSA-N |
| XLogP | 5.87 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 166639295 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 166639295?
The IUPAC name of CID 166639295 (CID 166639295) is not available.
What is the SMILES notation for CID 166639295?
The canonical SMILES for CID 166639295 is C[C@@H]([C]1[CH][CH][CH][C]1[P+](=O)C(C)(C)C)P(c1ccccc1)c1ccccc1.
What is the InChIKey of CID 166639295?
The InChIKey is CUZHJOIDDRCKKU-SFHVURJKSA-N. The full InChI is InChI=1S/C23H26OP2/c1-18(21-16-11-17-22(21)26(24)23(2,3)4)25(19-12-7-5-8-13-19)20-14-9-6-10-15-20/h5-18H,1-4H3/q+1/t18-/m0/s1.
What are the key properties of CID 166639295?
CID 166639295 has a molecular weight of 380.41 g/mol, XLogP of 5.87, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 166639295 is sourced from PubChem (CID 166639295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).