C20H25ClN6O4 — CID 166643407
diethyl 2-[2-[4-(3-amino-6-chloropyridazin-4-yl)piperazin-1-yl]-4-pyridinyl]propanedioate (PubChem CID 166643407) has the molecular formula C20H25ClN6O4 and a molecular weight of 448.91 g/mol. Its IUPAC name is diethyl 2-[2-[4-(3-amino-6-chloropyridazin-4-yl)piperazin-1-yl]-4-pyridinyl]propanedioate.
| Compound Name | diethyl 2-[2-[4-(3-amino-6-chloropyridazin-4-yl)piperazin-1-yl]-4-pyridinyl]propanedioate |
|---|---|
| PubChem CID | 166643407 |
| Molecular Formula | C20H25ClN6O4 |
| Molecular Weight | 448.91 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | diethyl 2-[2-[4-(3-amino-6-chloropyridazin-4-yl)piperazin-1-yl]-4-pyridinyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)c1ccnc(N2CCN(c3cc(Cl)nnc3N)CC2)c1 |
| InChI | InChI=1S/C20H25ClN6O4/c1-3-30-19(28)17(20(29)31-4-2)13-5-6-23-16(11-13)27-9-7-26(8-10-27)14-12-15(21)24-25-18(14)22/h5-6,11-12,17H,3-4,7-10H2,1-2H3,(H2,22,25) |
| InChIKey | JPLNTNIXNJZABU-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 123.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.91 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|