C25H21Cl2F7N4O6 — CID 166644668
4-[[(2S)-2-[[2-[[2-(2,5-dichlorophenyl)-2,2-difluoroacetyl]amino]acetyl]amino]-2-(4-methoxyphenyl)acetyl]amino]-2,2-difluoro-3-oxo-N-(2,2,2-trifluoroethyl)butanamide (PubChem CID 166644668) has the molecular formula C25H21Cl2F7N4O6 and a molecular weight of 677.36 g/mol. Its IUPAC name is 4-[[(2S)-2-[[2-[[2-(2,5-dichlorophenyl)-2,2-difluoroacetyl]amino]acetyl]amino]-2-(4-methoxyphenyl)acetyl]amino]-2,2-difluoro-3-oxo-N-(2,2,2-trifluoroethyl)butanamide.
| Compound Name | 4-[[(2S)-2-[[2-[[2-(2,5-dichlorophenyl)-2,2-difluoroacetyl]amino]acetyl]amino]-2-(4-methoxyphenyl)acetyl]amino]-2,2-difluoro-3-oxo-N-(2,2,2-trifluoroethyl)butanamide |
|---|---|
| PubChem CID | 166644668 |
| Molecular Formula | C25H21Cl2F7N4O6 |
| Molecular Weight | 677.36 g/mol |
| Exact Mass | 676.07 |
| IUPAC Name | 4-[[(2S)-2-[[2-[[2-(2,5-dichlorophenyl)-2,2-difluoroacetyl]amino]acetyl]amino]-2-(4-methoxyphenyl)acetyl]amino]-2,2-difluoro-3-oxo-N-(2,2,2-trifluoroethyl)butanamide |
| SMILES | COc1ccc([C@H](NC(=O)CNC(=O)C(F)(F)c2cc(Cl)ccc2Cl)C(=O)NCC(=O)C(F)(F)C(=O)NCC(F)(F)F)cc1 |
| InChI | InChI=1S/C25H21Cl2F7N4O6/c1-44-14-5-2-12(3-6-14)19(20(41)35-9-17(39)25(33,34)22(43)37-11-23(28,29)30)38-18(40)10-36-21(42)24(31,32)15-8-13(26)4-7-16(15)27/h2-8,19H,9-11H2,1H3,(H,35,41)(H,36,42)(H,37,43)(H,38,40)/t19-/m0/s1 |
| InChIKey | DDFQQCCHKTVRSI-IBGZPJMESA-N |
| XLogP | 3.07 |
| TPSA | 142.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|