C22H22FN7O2 — CID 166647472
N-[[4-(3-cyano-2-methoxyanilino)-6-[(5-fluoro-4-methyl-2-pyridinyl)amino]-3-methyl-2-pyridinyl]amino]-N-methylformamide (PubChem CID 166647472) has the molecular formula C22H22FN7O2 and a molecular weight of 435.46 g/mol. Its IUPAC name is N-[[4-(3-cyano-2-methoxyanilino)-6-[(5-fluoro-4-methyl-2-pyridinyl)amino]-3-methyl-2-pyridinyl]amino]-N-methylformamide.
| Compound Name | N-[[4-(3-cyano-2-methoxyanilino)-6-[(5-fluoro-4-methyl-2-pyridinyl)amino]-3-methyl-2-pyridinyl]amino]-N-methylformamide |
|---|---|
| PubChem CID | 166647472 |
| Molecular Formula | C22H22FN7O2 |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | N-[[4-(3-cyano-2-methoxyanilino)-6-[(5-fluoro-4-methyl-2-pyridinyl)amino]-3-methyl-2-pyridinyl]amino]-N-methylformamide |
| SMILES | COc1c(C#N)cccc1Nc1cc(Nc2cc(C)c(F)cn2)nc(NN(C)C=O)c1C |
| InChI | InChI=1S/C22H22FN7O2/c1-13-8-19(25-11-16(13)23)27-20-9-18(14(2)22(28-20)29-30(3)12-31)26-17-7-5-6-15(10-24)21(17)32-4/h5-9,11-12H,1-4H3,(H3,25,26,27,28,29) |
| InChIKey | KARBMPFRGVTXSP-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 115.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|