C8H12ClN — CID 166648338
N-[(2Z,4E)-4-(chloromethyl)hexa-2,4-dien-2-yl]methanimine (PubChem CID 166648338) has the molecular formula C8H12ClN and a molecular weight of 157.64 g/mol. Its IUPAC name is N-[(2Z,4E)-4-(chloromethyl)hexa-2,4-dien-2-yl]methanimine.
| Compound Name | N-[(2Z,4E)-4-(chloromethyl)hexa-2,4-dien-2-yl]methanimine |
|---|---|
| PubChem CID | 166648338 |
| Molecular Formula | C8H12ClN |
| Molecular Weight | 157.64 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | N-[(2Z,4E)-4-(chloromethyl)hexa-2,4-dien-2-yl]methanimine |
| SMILES | C=N/C(C)=C\C(=C/C)CCl |
| InChI | InChI=1S/C8H12ClN/c1-4-8(6-9)5-7(2)10-3/h4-5H,3,6H2,1-2H3/b7-5-,8-4+ |
| InChIKey | WPFLBTVMXIYDMS-DZAKWUEVSA-N |
| XLogP | 2.78 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.64 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|