C21H16F3O2P — CID 166651658
2,3-dimethyl-5-(2,3,6-trifluoro-4-phenyl-5-phosphanylphenyl)benzoic acid (PubChem CID 166651658) has the molecular formula C21H16F3O2P and a molecular weight of 388.33 g/mol. Its IUPAC name is 2,3-dimethyl-5-(2,3,6-trifluoro-4-phenyl-5-phosphanylphenyl)benzoic acid.
| Compound Name | 2,3-dimethyl-5-(2,3,6-trifluoro-4-phenyl-5-phosphanylphenyl)benzoic acid |
|---|---|
| PubChem CID | 166651658 |
| Molecular Formula | C21H16F3O2P |
| Molecular Weight | 388.33 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 2,3-dimethyl-5-(2,3,6-trifluoro-4-phenyl-5-phosphanylphenyl)benzoic acid |
| SMILES | Cc1cc(-c2c(F)c(F)c(-c3ccccc3)c(P)c2F)cc(C(=O)O)c1C |
| InChI | InChI=1S/C21H16F3O2P/c1-10-8-13(9-14(11(10)2)21(25)26)15-17(22)18(23)16(20(27)19(15)24)12-6-4-3-5-7-12/h3-9H,27H2,1-2H3,(H,25,26) |
| InChIKey | PQNRCYAJYFXJKV-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.33 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|