C32H24N4O — CID 166656801
N-[amino(phenyl)methylidene]-2-(1,3-benzoxazol-2-yl)-N'-benzylnaphthalene-1-carboximidamide (PubChem CID 166656801) has the molecular formula C32H24N4O and a molecular weight of 480.57 g/mol. Its IUPAC name is N-[amino(phenyl)methylidene]-2-(1,3-benzoxazol-2-yl)-N'-benzylnaphthalene-1-carboximidamide.
| Compound Name | N-[amino(phenyl)methylidene]-2-(1,3-benzoxazol-2-yl)-N'-benzylnaphthalene-1-carboximidamide |
|---|---|
| PubChem CID | 166656801 |
| Molecular Formula | C32H24N4O |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | N-[amino(phenyl)methylidene]-2-(1,3-benzoxazol-2-yl)-N'-benzylnaphthalene-1-carboximidamide |
| SMILES | N/C(=N\C(=N/Cc1ccccc1)c1c(-c2nc3ccccc3o2)ccc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C32H24N4O/c33-30(24-14-5-2-6-15-24)36-31(34-21-22-11-3-1-4-12-22)29-25-16-8-7-13-23(25)19-20-26(29)32-35-27-17-9-10-18-28(27)37-32/h1-20H,21H2,(H2,33,34,36) |
| InChIKey | BTZQVYMPOCHFEK-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 76.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|