C28H40BrN3O2 — CID 166691502
[4-[[4-[5-bromo-1-(cyclohexylmethyl)indol-3-yl]cyclohexyl]amino]cyclohexyl]carbamic acid (PubChem CID 166691502) has the molecular formula C28H40BrN3O2 and a molecular weight of 530.55 g/mol. Its IUPAC name is [4-[[4-[5-bromo-1-(cyclohexylmethyl)indol-3-yl]cyclohexyl]amino]cyclohexyl]carbamic acid.
| Compound Name | [4-[[4-[5-bromo-1-(cyclohexylmethyl)indol-3-yl]cyclohexyl]amino]cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 166691502 |
| Molecular Formula | C28H40BrN3O2 |
| Molecular Weight | 530.55 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | [4-[[4-[5-bromo-1-(cyclohexylmethyl)indol-3-yl]cyclohexyl]amino]cyclohexyl]carbamic acid |
| SMILES | O=C(O)NC1CCC(NC2CCC(c3cn(CC4CCCCC4)c4ccc(Br)cc34)CC2)CC1 |
| InChI | InChI=1S/C28H40BrN3O2/c29-21-8-15-27-25(16-21)26(18-32(27)17-19-4-2-1-3-5-19)20-6-9-22(10-7-20)30-23-11-13-24(14-12-23)31-28(33)34/h8,15-16,18-20,22-24,30-31H,1-7,9-14,17H2,(H,33,34) |
| InChIKey | BROGFWWYDHLEEG-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.55 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |