C16H14O8 — CID 166703971
3-[4-(3,4-dihydroxybenzoyl)peroxy-3-hydroxyphenyl]propanoic acid (PubChem CID 166703971) has the molecular formula C16H14O8 and a molecular weight of 334.28 g/mol. Its IUPAC name is 3-[4-(3,4-dihydroxybenzoyl)peroxy-3-hydroxyphenyl]propanoic acid.
| Compound Name | 3-[4-(3,4-dihydroxybenzoyl)peroxy-3-hydroxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 166703971 |
| Molecular Formula | C16H14O8 |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 3-[4-(3,4-dihydroxybenzoyl)peroxy-3-hydroxyphenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(OOC(=O)c2ccc(O)c(O)c2)c(O)c1 |
| InChI | InChI=1S/C16H14O8/c17-11-4-3-10(8-12(11)18)16(22)24-23-14-5-1-9(7-13(14)19)2-6-15(20)21/h1,3-5,7-8,17-19H,2,6H2,(H,20,21) |
| InChIKey | DCEBSYIDDZQHQW-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|