C26H45N7O6 — CID 166705078
N-[2-[2-[2-(4-acetamidophenoxy)ethoxy]ethoxy]ethyl]-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanamide (PubChem CID 166705078) has the molecular formula C26H45N7O6 and a molecular weight of 551.69 g/mol. Its IUPAC name is N-[2-[2-[2-(4-acetamidophenoxy)ethoxy]ethoxy]ethyl]-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanamide.
| Compound Name | N-[2-[2-[2-(4-acetamidophenoxy)ethoxy]ethoxy]ethyl]-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanamide |
|---|---|
| PubChem CID | 166705078 |
| Molecular Formula | C26H45N7O6 |
| Molecular Weight | 551.69 g/mol |
| Exact Mass | 551.34 |
| IUPAC Name | N-[2-[2-[2-(4-acetamidophenoxy)ethoxy]ethoxy]ethyl]-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanamide |
| SMILES | CCCCC(NC(=O)[C@@H](N)CCCN=C(N)N)C(=O)NCCOCCOCCOc1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C26H45N7O6/c1-3-4-7-23(33-24(35)22(27)6-5-12-31-26(28)29)25(36)30-13-14-37-15-16-38-17-18-39-21-10-8-20(9-11-21)32-19(2)34/h8-11,22-23H,3-7,12-18,27H2,1-2H3,(H,30,36)(H,32,34)(H,33,35)(H4,28,29,31)/t22-,23?/m0/s1 |
| InChIKey | YRMRAJDKESHKMP-NQCNTLBGSA-N |
| XLogP | 0.23 |
| TPSA | 205.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.69 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|