C27H38N4O5 — CID 154993764
2,6-diacetamido-N-[2-[2-[4-[amino(phenyl)methyl]phenoxy]ethoxy]ethyl]hexanamide (PubChem CID 154993764) has the molecular formula C27H38N4O5 and a molecular weight of 498.62 g/mol. Its IUPAC name is 2,6-diacetamido-N-[2-[2-[4-[amino(phenyl)methyl]phenoxy]ethoxy]ethyl]hexanamide.
| Compound Name | 2,6-diacetamido-N-[2-[2-[4-[amino(phenyl)methyl]phenoxy]ethoxy]ethyl]hexanamide |
|---|---|
| PubChem CID | 154993764 |
| Molecular Formula | C27H38N4O5 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | 2,6-diacetamido-N-[2-[2-[4-[amino(phenyl)methyl]phenoxy]ethoxy]ethyl]hexanamide |
| SMILES | CC(=O)NCCCCC(NC(C)=O)C(=O)NCCOCCOc1ccc(C(N)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H38N4O5/c1-20(32)29-15-7-6-10-25(31-21(2)33)27(34)30-16-17-35-18-19-36-24-13-11-23(12-14-24)26(28)22-8-4-3-5-9-22/h3-5,8-9,11-14,25-26H,6-7,10,15-19,28H2,1-2H3,(H,29,32)(H,30,34)(H,31,33) |
| InChIKey | GNCDZGANCRSEMW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|