C17H27N3O6S — CID 16670758
(3R,5S)-5-(3,4-dimethoxyphenyl)-N-(1-hydroxy-2-methylpropan-2-yl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide (PubChem CID 16670758) has the molecular formula C17H27N3O6S and a molecular weight of 401.49 g/mol. Its IUPAC name is (3R,5S)-5-(3,4-dimethoxyphenyl)-N-(1-hydroxy-2-methylpropan-2-yl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide.
| Compound Name | (3R,5S)-5-(3,4-dimethoxyphenyl)-N-(1-hydroxy-2-methylpropan-2-yl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide |
|---|---|
| PubChem CID | 16670758 |
| Molecular Formula | C17H27N3O6S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | (3R,5S)-5-(3,4-dimethoxyphenyl)-N-(1-hydroxy-2-methylpropan-2-yl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide |
| SMILES | COc1ccc([C@@H]2C[C@H](C(=O)NC(C)(C)CO)N(C)S(=O)(=O)N2)cc1OC |
| InChI | InChI=1S/C17H27N3O6S/c1-17(2,10-21)18-16(22)13-9-12(19-27(23,24)20(13)3)11-6-7-14(25-4)15(8-11)26-5/h6-8,12-13,19,21H,9-10H2,1-5H3,(H,18,22)/t12-,13+/m0/s1 |
| InChIKey | XZQONXBCNIGSBB-QWHCGFSZSA-N |
| XLogP | 0.17 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |