C21H28FN3O6 — CID 166709085
prop-2-enyl 4-fluoro-3-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoylamino]propanoylamino]benzoate (PubChem CID 166709085) has the molecular formula C21H28FN3O6 and a molecular weight of 437.47 g/mol. Its IUPAC name is prop-2-enyl 4-fluoro-3-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoylamino]propanoylamino]benzoate.
| Compound Name | prop-2-enyl 4-fluoro-3-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoylamino]propanoylamino]benzoate |
|---|---|
| PubChem CID | 166709085 |
| Molecular Formula | C21H28FN3O6 |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | prop-2-enyl 4-fluoro-3-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoylamino]propanoylamino]benzoate |
| SMILES | C=CCOC(=O)c1ccc(F)c(NC(=O)C(C)NC(=O)C(C)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C21H28FN3O6/c1-7-10-30-19(28)14-8-9-15(22)16(11-14)25-18(27)12(2)23-17(26)13(3)24-20(29)31-21(4,5)6/h7-9,11-13H,1,10H2,2-6H3,(H,23,26)(H,24,29)(H,25,27) |
| InChIKey | JYXDLSHSPBKMNW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|