C15H33NO9 — CID 166709227
6-hydroxyhexanoic acid;propan-1-amine;2,2,3,3-tetrahydroxyhexanoic acid (PubChem CID 166709227) has the molecular formula C15H33NO9 and a molecular weight of 371.43 g/mol. Its IUPAC name is 6-hydroxyhexanoic acid;propan-1-amine;2,2,3,3-tetrahydroxyhexanoic acid.
| Compound Name | 6-hydroxyhexanoic acid;propan-1-amine;2,2,3,3-tetrahydroxyhexanoic acid |
|---|---|
| PubChem CID | 166709227 |
| Molecular Formula | C15H33NO9 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 6-hydroxyhexanoic acid;propan-1-amine;2,2,3,3-tetrahydroxyhexanoic acid |
| SMILES | CCCC(O)(O)C(O)(O)C(=O)O.CCCN.O=C(O)CCCCCO |
| InChI | InChI=1S/C6H12O6.C6H12O3.C3H9N/c1-2-3-5(9,10)6(11,12)4(7)8;7-5-3-1-2-4-6(8)9;1-2-3-4/h9-12H,2-3H2,1H3,(H,7,8);7H,1-5H2,(H,8,9);2-4H2,1H3 |
| InChIKey | SHWNVEWCTNPUMZ-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 201.77 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|