C17H36N2O4 — CID 166714983
N-[(2R)-3,3-dimethylbutan-2-yl]-3-[3-[2-[2-(methylamino)ethoxy]ethoxy]propoxy]propanamide (PubChem CID 166714983) has the molecular formula C17H36N2O4 and a molecular weight of 332.49 g/mol. Its IUPAC name is N-[(2R)-3,3-dimethylbutan-2-yl]-3-[3-[2-[2-(methylamino)ethoxy]ethoxy]propoxy]propanamide.
| Compound Name | N-[(2R)-3,3-dimethylbutan-2-yl]-3-[3-[2-[2-(methylamino)ethoxy]ethoxy]propoxy]propanamide |
|---|---|
| PubChem CID | 166714983 |
| Molecular Formula | C17H36N2O4 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | N-[(2R)-3,3-dimethylbutan-2-yl]-3-[3-[2-[2-(methylamino)ethoxy]ethoxy]propoxy]propanamide |
| SMILES | CNCCOCCOCCCOCCC(=O)N[C@H](C)C(C)(C)C |
| InChI | InChI=1S/C17H36N2O4/c1-15(17(2,3)4)19-16(20)7-11-21-9-6-10-22-13-14-23-12-8-18-5/h15,18H,6-14H2,1-5H3,(H,19,20)/t15-/m1/s1 |
| InChIKey | NGAWHMAHUBZKFC-OAHLLOKOSA-N |
| XLogP | 1.59 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|