C27H34N4O10 — CID 166718529
3-[[2-[2-(6-aminohexylamino)-2-oxoethoxy]-3-[(3-carboxy-2-hydroxybenzoyl)amino]propyl]carbamoyl]-2-hydroxybenzoic acid (PubChem CID 166718529) has the molecular formula C27H34N4O10 and a molecular weight of 574.59 g/mol. Its IUPAC name is 3-[[2-[2-(6-aminohexylamino)-2-oxoethoxy]-3-[(3-carboxy-2-hydroxybenzoyl)amino]propyl]carbamoyl]-2-hydroxybenzoic acid.
| Compound Name | 3-[[2-[2-(6-aminohexylamino)-2-oxoethoxy]-3-[(3-carboxy-2-hydroxybenzoyl)amino]propyl]carbamoyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 166718529 |
| Molecular Formula | C27H34N4O10 |
| Molecular Weight | 574.59 g/mol |
| Exact Mass | 574.23 |
| IUPAC Name | 3-[[2-[2-(6-aminohexylamino)-2-oxoethoxy]-3-[(3-carboxy-2-hydroxybenzoyl)amino]propyl]carbamoyl]-2-hydroxybenzoic acid |
| SMILES | NCCCCCCNC(=O)COC(CNC(=O)c1cccc(C(=O)O)c1O)CNC(=O)c1cccc(C(=O)O)c1O |
| InChI | InChI=1S/C27H34N4O10/c28-11-3-1-2-4-12-29-21(32)15-41-16(13-30-24(35)17-7-5-9-19(22(17)33)26(37)38)14-31-25(36)18-8-6-10-20(23(18)34)27(39)40/h5-10,16,33-34H,1-4,11-15,28H2,(H,29,32)(H,30,35)(H,31,36)(H,37,38)(H,39,40) |
| InChIKey | BSGCXZIWBIWONI-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 237.61 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.59 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|