C9H15FN2S — CID 166723628
6-fluoro-4,5-diimino-3,6-dimethylhept-1-ene-2-thiol (PubChem CID 166723628) has the molecular formula C9H15FN2S and a molecular weight of 202.30 g/mol. Its IUPAC name is 6-fluoro-4,5-diimino-3,6-dimethylhept-1-ene-2-thiol.
| Compound Name | 6-fluoro-4,5-diimino-3,6-dimethylhept-1-ene-2-thiol |
|---|---|
| PubChem CID | 166723628 |
| Molecular Formula | C9H15FN2S |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 6-fluoro-4,5-diimino-3,6-dimethylhept-1-ene-2-thiol |
| SMILES | [H]/N=C(C(=N/[H])/C(C)C(=C)S)\C(C)(C)F |
| InChI | InChI=1S/C9H15FN2S/c1-5(6(2)13)7(11)8(12)9(3,4)10/h5,11-13H,2H2,1,3-4H3/b11-7+,12-8- |
| InChIKey | JQFTXOHMWJWDAQ-RLCSYUECSA-N |
| XLogP | 2.85 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|