C23H24N4O3 — CID 166726399
1-methyl-6-[2-[7-(1,2-oxazol-3-yl)-7-oxoheptyl]-1H-imidazol-5-yl]quinolin-2-one (PubChem CID 166726399) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is 1-methyl-6-[2-[7-(1,2-oxazol-3-yl)-7-oxoheptyl]-1H-imidazol-5-yl]quinolin-2-one.
| Compound Name | 1-methyl-6-[2-[7-(1,2-oxazol-3-yl)-7-oxoheptyl]-1H-imidazol-5-yl]quinolin-2-one |
|---|---|
| PubChem CID | 166726399 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 1-methyl-6-[2-[7-(1,2-oxazol-3-yl)-7-oxoheptyl]-1H-imidazol-5-yl]quinolin-2-one |
| SMILES | Cn1c(=O)ccc2cc(-c3cnc(CCCCCCC(=O)c4ccon4)[nH]3)ccc21 |
| InChI | InChI=1S/C23H24N4O3/c1-27-20-10-8-16(14-17(20)9-11-23(27)29)19-15-24-22(25-19)7-5-3-2-4-6-21(28)18-12-13-30-26-18/h8-15H,2-7H2,1H3,(H,24,25) |
| InChIKey | LMVSTCXXEIYKJX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|