C27H28N2O6 — CID 166726787
cyclohexa-2,4-dien-1-ylmethyl 2-[[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]methoxy]acetate (PubChem CID 166726787) has the molecular formula C27H28N2O6 and a molecular weight of 476.53 g/mol. Its IUPAC name is cyclohexa-2,4-dien-1-ylmethyl 2-[[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]methoxy]acetate.
| Compound Name | cyclohexa-2,4-dien-1-ylmethyl 2-[[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]methoxy]acetate |
|---|---|
| PubChem CID | 166726787 |
| Molecular Formula | C27H28N2O6 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | cyclohexa-2,4-dien-1-ylmethyl 2-[[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]methoxy]acetate |
| SMILES | O=C(CNC(=O)OCC1c2ccccc2-c2ccccc21)NCOCC(=O)OCC1C=CC=CC1 |
| InChI | InChI=1S/C27H28N2O6/c30-25(29-18-33-17-26(31)34-15-19-8-2-1-3-9-19)14-28-27(32)35-16-24-22-12-6-4-10-20(22)21-11-5-7-13-23(21)24/h1-8,10-13,19,24H,9,14-18H2,(H,28,32)(H,29,30) |
| InChIKey | FJPACIHYDWKILK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|