C15H26N4O5 — CID 166728601
butyl 2-[(3R,4S)-4-azidooxolan-3-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (PubChem CID 166728601) has the molecular formula C15H26N4O5 and a molecular weight of 342.40 g/mol. Its IUPAC name is butyl 2-[(3R,4S)-4-azidooxolan-3-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate.
| Compound Name | butyl 2-[(3R,4S)-4-azidooxolan-3-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
|---|---|
| PubChem CID | 166728601 |
| Molecular Formula | C15H26N4O5 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | butyl 2-[(3R,4S)-4-azidooxolan-3-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| SMILES | CCCCOC(=O)C(NC(=O)OC(C)(C)C)[C@H]1COC[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C15H26N4O5/c1-5-6-7-23-13(20)12(17-14(21)24-15(2,3)4)10-8-22-9-11(10)18-19-16/h10-12H,5-9H2,1-4H3,(H,17,21)/t10-,11+,12?/m0/s1 |
| InChIKey | JQZSWMOVHRHCNH-WIKAKEFZSA-N |
| XLogP | 2.55 |
| TPSA | 122.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|