C11H18N4O5 — CID 175139557
2-[(3S,4S)-4-azidooxolan-3-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (PubChem CID 175139557) has the molecular formula C11H18N4O5 and a molecular weight of 286.29 g/mol. Its IUPAC name is 2-[(3S,4S)-4-azidooxolan-3-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid.
| Compound Name | 2-[(3S,4S)-4-azidooxolan-3-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
|---|---|
| PubChem CID | 175139557 |
| Molecular Formula | C11H18N4O5 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 2-[(3S,4S)-4-azidooxolan-3-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| SMILES | CC(C)(C)OC(=O)NC(C(=O)O)[C@@H]1COC[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C11H18N4O5/c1-11(2,3)20-10(18)13-8(9(16)17)6-4-19-5-7(6)14-15-12/h6-8H,4-5H2,1-3H3,(H,13,18)(H,16,17)/t6-,7-,8?/m1/s1 |
| InChIKey | WWFBBLXSQPFYBC-GCJDJSOWSA-N |
| XLogP | 1.29 |
| TPSA | 133.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|