C24H32N4O — CID 16673977
2-[3-[(4-but-3-ynylpiperazin-1-yl)methyl]-2-methylindol-1-yl]-1-pyrrolidin-1-ylethanone (PubChem CID 16673977) has the molecular formula C24H32N4O and a molecular weight of 392.55 g/mol. Its IUPAC name is 2-[3-[(4-but-3-ynylpiperazin-1-yl)methyl]-2-methylindol-1-yl]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[3-[(4-but-3-ynylpiperazin-1-yl)methyl]-2-methylindol-1-yl]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 16673977 |
| Molecular Formula | C24H32N4O |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | 2-[3-[(4-but-3-ynylpiperazin-1-yl)methyl]-2-methylindol-1-yl]-1-pyrrolidin-1-ylethanone |
| SMILES | C#CCCN1CCN(Cc2c(C)n(CC(=O)N3CCCC3)c3ccccc23)CC1 |
| InChI | InChI=1S/C24H32N4O/c1-3-4-11-25-14-16-26(17-15-25)18-22-20(2)28(23-10-6-5-9-21(22)23)19-24(29)27-12-7-8-13-27/h1,5-6,9-10H,4,7-8,11-19H2,2H3 |
| InChIKey | XNFJXPQRVCCHPQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 31.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|