C20H25N3O4S — CID 166742184
(E)-N-tert-butyl-3-ethenyl-2-(N-prop-2-ynoyl-4-sulfamoylanilino)pent-3-enamide (PubChem CID 166742184) has the molecular formula C20H25N3O4S and a molecular weight of 403.50 g/mol. Its IUPAC name is (E)-N-tert-butyl-3-ethenyl-2-(N-prop-2-ynoyl-4-sulfamoylanilino)pent-3-enamide.
| Compound Name | (E)-N-tert-butyl-3-ethenyl-2-(N-prop-2-ynoyl-4-sulfamoylanilino)pent-3-enamide |
|---|---|
| PubChem CID | 166742184 |
| Molecular Formula | C20H25N3O4S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | (E)-N-tert-butyl-3-ethenyl-2-(N-prop-2-ynoyl-4-sulfamoylanilino)pent-3-enamide |
| SMILES | C#CC(=O)N(c1ccc(S(N)(=O)=O)cc1)C(C(=O)NC(C)(C)C)/C(C=C)=C/C |
| InChI | InChI=1S/C20H25N3O4S/c1-7-14(8-2)18(19(25)22-20(4,5)6)23(17(24)9-3)15-10-12-16(13-11-15)28(21,26)27/h3,7-8,10-13,18H,1H2,2,4-6H3,(H,22,25)(H2,21,26,27)/b14-8+ |
| InChIKey | WCZOYRKHPHXETI-RIYZIHGNSA-N |
| XLogP | 1.72 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|