C20H17F6N5O2 — CID 166745043
(E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-4-methyl-2-(1-methylpyrazol-4-yl)pent-2-enoic acid (PubChem CID 166745043) has the molecular formula C20H17F6N5O2 and a molecular weight of 473.38 g/mol. Its IUPAC name is (E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-4-methyl-2-(1-methylpyrazol-4-yl)pent-2-enoic acid.
| Compound Name | (E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-4-methyl-2-(1-methylpyrazol-4-yl)pent-2-enoic acid |
|---|---|
| PubChem CID | 166745043 |
| Molecular Formula | C20H17F6N5O2 |
| Molecular Weight | 473.38 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | (E)-3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-4-methyl-2-(1-methylpyrazol-4-yl)pent-2-enoic acid |
| SMILES | CC(C)/C(=C(\C(=O)O)c1cnn(C)c1)n1cnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C20H17F6N5O2/c1-10(2)16(15(18(32)33)12-7-28-30(3)8-12)31-9-27-17(29-31)11-4-13(19(21,22)23)6-14(5-11)20(24,25)26/h4-10H,1-3H3,(H,32,33)/b16-15+ |
| InChIKey | MYBGISVASOTQLP-FOCLMDBBSA-N |
| XLogP | 4.83 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.38 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|