C50H38O6 — CID 166761359
4-[[2-[4-[bis(2-hydroxyphenyl)-phenylmethyl]phenoxy]-4-hydroxyphenyl]-diphenylmethyl]benzene-1,3-diol (PubChem CID 166761359) has the molecular formula C50H38O6 and a molecular weight of 734.85 g/mol. Its IUPAC name is 4-[[2-[4-[bis(2-hydroxyphenyl)-phenylmethyl]phenoxy]-4-hydroxyphenyl]-diphenylmethyl]benzene-1,3-diol.
| Compound Name | 4-[[2-[4-[bis(2-hydroxyphenyl)-phenylmethyl]phenoxy]-4-hydroxyphenyl]-diphenylmethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 166761359 |
| Molecular Formula | C50H38O6 |
| Molecular Weight | 734.85 g/mol |
| Exact Mass | 734.27 |
| IUPAC Name | 4-[[2-[4-[bis(2-hydroxyphenyl)-phenylmethyl]phenoxy]-4-hydroxyphenyl]-diphenylmethyl]benzene-1,3-diol |
| SMILES | Oc1ccc(C(c2ccccc2)(c2ccccc2)c2ccc(O)cc2Oc2ccc(C(c3ccccc3)(c3ccccc3O)c3ccccc3O)cc2)c(O)c1 |
| InChI | InChI=1S/C50H38O6/c51-38-26-30-43(47(55)32-38)50(35-16-6-2-7-17-35,36-18-8-3-9-19-36)44-31-27-39(52)33-48(44)56-40-28-24-37(25-29-40)49(34-14-4-1-5-15-34,41-20-10-12-22-45(41)53)42-21-11-13-23-46(42)54/h1-33,51-55H |
| InChIKey | WTIKIWFRVKLDFA-UHFFFAOYSA-N |
| XLogP | 10.77 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.85 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|