C19H21F2N2O4P — CID 166772299
N-[(2,4-difluorophenyl)methyl]-(2-oxo-1-phenylmethoxypiperidin-3-yl)phosphonamidic acid (PubChem CID 166772299) has the molecular formula C19H21F2N2O4P and a molecular weight of 410.36 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-(2-oxo-1-phenylmethoxypiperidin-3-yl)phosphonamidic acid.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-(2-oxo-1-phenylmethoxypiperidin-3-yl)phosphonamidic acid |
|---|---|
| PubChem CID | 166772299 |
| Molecular Formula | C19H21F2N2O4P |
| Molecular Weight | 410.36 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-(2-oxo-1-phenylmethoxypiperidin-3-yl)phosphonamidic acid |
| SMILES | O=C1C(P(=O)(O)NCc2ccc(F)cc2F)CCCN1OCc1ccccc1 |
| InChI | InChI=1S/C19H21F2N2O4P/c20-16-9-8-15(17(21)11-16)12-22-28(25,26)18-7-4-10-23(19(18)24)27-13-14-5-2-1-3-6-14/h1-3,5-6,8-9,11,18H,4,7,10,12-13H2,(H2,22,25,26) |
| InChIKey | PZKKNKUCCJYCOT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.36 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|