C16H24N2O3 — CID 166789012
N-(tert-butylamino)oxy-4-(2,2-dimethylpropanoyl)benzamide (PubChem CID 166789012) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is N-(tert-butylamino)oxy-4-(2,2-dimethylpropanoyl)benzamide.
| Compound Name | N-(tert-butylamino)oxy-4-(2,2-dimethylpropanoyl)benzamide |
|---|---|
| PubChem CID | 166789012 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | N-(tert-butylamino)oxy-4-(2,2-dimethylpropanoyl)benzamide |
| SMILES | CC(C)(C)NONC(=O)c1ccc(C(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H24N2O3/c1-15(2,3)13(19)11-7-9-12(10-8-11)14(20)17-21-18-16(4,5)6/h7-10,18H,1-6H3,(H,17,20) |
| InChIKey | KGJGAVSBWGNQLR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|