C24H21FN2O3 — CID 166790625
3-(4-fluorophenyl)-4-[(3-phenylphenyl)carbamoyl]pyrrolidine-1-carboxylic acid (PubChem CID 166790625) has the molecular formula C24H21FN2O3 and a molecular weight of 404.44 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-4-[(3-phenylphenyl)carbamoyl]pyrrolidine-1-carboxylic acid.
| Compound Name | 3-(4-fluorophenyl)-4-[(3-phenylphenyl)carbamoyl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 166790625 |
| Molecular Formula | C24H21FN2O3 |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 3-(4-fluorophenyl)-4-[(3-phenylphenyl)carbamoyl]pyrrolidine-1-carboxylic acid |
| SMILES | O=C(Nc1cccc(-c2ccccc2)c1)C1CN(C(=O)O)CC1c1ccc(F)cc1 |
| InChI | InChI=1S/C24H21FN2O3/c25-19-11-9-17(10-12-19)21-14-27(24(29)30)15-22(21)23(28)26-20-8-4-7-18(13-20)16-5-2-1-3-6-16/h1-13,21-22H,14-15H2,(H,26,28)(H,29,30) |
| InChIKey | VRBZUWDYBOQMTE-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |