C13H19NO2 — CID 166796250
6-tert-butyl-7-methyl-7,8-dihydro-4H-1,4-benzoxazin-3-one (PubChem CID 166796250) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 6-tert-butyl-7-methyl-7,8-dihydro-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-tert-butyl-7-methyl-7,8-dihydro-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 166796250 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 6-tert-butyl-7-methyl-7,8-dihydro-4H-1,4-benzoxazin-3-one |
| SMILES | CC1CC2=C(C=C1C(C)(C)C)NC(=O)CO2 |
| InChI | InChI=1S/C13H19NO2/c1-8-5-11-10(14-12(15)7-16-11)6-9(8)13(2,3)4/h6,8H,5,7H2,1-4H3,(H,14,15) |
| InChIKey | YMKIVSOHRVYSHG-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |