About 6-tert-butyl-7-methyl-7,8-dihydro-4H-1,4-benzoxazin-3-one
6-tert-butyl-7-methyl-7,8-dihydro-4H-1,4-benzoxazin-3-one (PubChem CID 166796250) has the molecular formula C13H19NO2
and a molecular weight of 221.30 g/mol. Its IUPAC name is 6-tert-butyl-7-methyl-7,8-dihydro-4H-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 6-tert-butyl-7-methyl-7,8-dihydro-4H-1,4-benzoxazin-3-one |
| PubChem CID | 166796250 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 6-tert-butyl-7-methyl-7,8-dihydro-4H-1,4-benzoxazin-3-one |
| SMILES | CC1CC2=C(C=C1C(C)(C)C)NC(=O)CO2 |
| InChI | InChI=1S/C13H19NO2/c1-8-5-11-10(14-12(15)7-16-11)6-9(8)13(2,3)4/h6,8H,5,7H2,1-4H3,(H,14,15) |
| InChIKey | YMKIVSOHRVYSHG-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-tert-butyl-7-methyl-7,8-dihydro-4H-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-7-methyl-7,8-dihydro-4H-1,4-benzoxazin-3-one?
The IUPAC name of 6-tert-butyl-7-methyl-7,8-dihydro-4H-1,4-benzoxazin-3-one (CID 166796250) is 6-tert-butyl-7-methyl-7,8-dihydro-4H-1,4-benzoxazin-3-one.
What is the SMILES notation for 6-tert-butyl-7-methyl-7,8-dihydro-4H-1,4-benzoxazin-3-one?
The canonical SMILES for 6-tert-butyl-7-methyl-7,8-dihydro-4H-1,4-benzoxazin-3-one is CC1CC2=C(C=C1C(C)(C)C)NC(=O)CO2.
What is the InChIKey of 6-tert-butyl-7-methyl-7,8-dihydro-4H-1,4-benzoxazin-3-one?
The InChIKey is YMKIVSOHRVYSHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2/c1-8-5-11-10(14-12(15)7-16-11)6-9(8)13(2,3)4/h6,8H,5,7H2,1-4H3,(H,14,15).
What are the key properties of 6-tert-butyl-7-methyl-7,8-dihydro-4H-1,4-benzoxazin-3-one?
6-tert-butyl-7-methyl-7,8-dihydro-4H-1,4-benzoxazin-3-one has a molecular weight of 221.30 g/mol, XLogP of 2.36, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-7-methyl-7,8-dihydro-4H-1,4-benzoxazin-3-one is sourced from PubChem (CID 166796250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).