C8H10N2O2 — CID 66936754
5-methyl-1,6-dihydropyrido[2,3-b][1,4]oxazin-2-one (PubChem CID 66936754) has the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. Its IUPAC name is 5-methyl-1,6-dihydropyrido[2,3-b][1,4]oxazin-2-one.
| Compound Name | 5-methyl-1,6-dihydropyrido[2,3-b][1,4]oxazin-2-one |
|---|---|
| PubChem CID | 66936754 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 5-methyl-1,6-dihydropyrido[2,3-b][1,4]oxazin-2-one |
| SMILES | CN1CC=CC2=C1OCC(=O)N2 |
| InChI | InChI=1S/C8H10N2O2/c1-10-4-2-3-6-8(10)12-5-7(11)9-6/h2-3H,4-5H2,1H3,(H,9,11) |
| InChIKey | QQWQSMGEIDYCPZ-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |