C10H13I2NO2 — CID 16679736
ethyl 4,5-diiodo-3-propyl-1H-pyrrole-2-carboxylate (PubChem CID 16679736) has the molecular formula C10H13I2NO2 and a molecular weight of 433.03 g/mol. Its IUPAC name is ethyl 4,5-diiodo-3-propyl-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 4,5-diiodo-3-propyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 16679736 |
| Molecular Formula | C10H13I2NO2 |
| Molecular Weight | 433.03 g/mol |
| Exact Mass | 432.90 |
| IUPAC Name | ethyl 4,5-diiodo-3-propyl-1H-pyrrole-2-carboxylate |
| SMILES | CCCc1c(C(=O)OCC)[nH]c(I)c1I |
| InChI | InChI=1S/C10H13I2NO2/c1-3-5-6-7(11)9(12)13-8(6)10(14)15-4-2/h13H,3-5H2,1-2H3 |
| InChIKey | SNYMLPWTWJGEIG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.03 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|