C21H22N4OS2 — CID 166798707
6-(cyclopropylsulfanylamino)-5-[(2-phenyl-1,3-thiazol-4-yl)methyl]-5,6,7,8-tetrahydro-3H-quinazolin-4-one (PubChem CID 166798707) has the molecular formula C21H22N4OS2 and a molecular weight of 410.57 g/mol. Its IUPAC name is 6-(cyclopropylsulfanylamino)-5-[(2-phenyl-1,3-thiazol-4-yl)methyl]-5,6,7,8-tetrahydro-3H-quinazolin-4-one.
| Compound Name | 6-(cyclopropylsulfanylamino)-5-[(2-phenyl-1,3-thiazol-4-yl)methyl]-5,6,7,8-tetrahydro-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 166798707 |
| Molecular Formula | C21H22N4OS2 |
| Molecular Weight | 410.57 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 6-(cyclopropylsulfanylamino)-5-[(2-phenyl-1,3-thiazol-4-yl)methyl]-5,6,7,8-tetrahydro-3H-quinazolin-4-one |
| SMILES | O=c1[nH]cnc2c1C(Cc1csc(-c3ccccc3)n1)C(NSC1CC1)CC2 |
| InChI | InChI=1S/C21H22N4OS2/c26-20-19-16(10-14-11-27-21(24-14)13-4-2-1-3-5-13)17(25-28-15-6-7-15)8-9-18(19)22-12-23-20/h1-5,11-12,15-17,25H,6-10H2,(H,22,23,26) |
| InChIKey | JCQSHRXRGIEMEP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.57 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|