C14H14N2O2 — CID 16680634
CID 16680634 (PubChem CID 16680634) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol.
| Compound Name | CID 16680634 |
|---|---|
| PubChem CID | 16680634 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | — |
| SMILES | O=C(NCCNC(=O)[C]1[CH][CH][CH][CH]1)[C]1[CH][CH][CH][CH]1 |
| InChI | InChI=1S/C14H14N2O2/c17-13(11-5-1-2-6-11)15-9-10-16-14(18)12-7-3-4-8-12/h1-8H,9-10H2,(H,15,17)(H,16,18) |
| InChIKey | GXVYRHYANBMYEM-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|