C16H21NO3 — CID 16680954
N-[(1S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl]-1-phenylmethanimine oxide (PubChem CID 16680954) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is N-[(1S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl]-1-phenylmethanimine oxide.
| Compound Name | N-[(1S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl]-1-phenylmethanimine oxide |
|---|---|
| PubChem CID | 16680954 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | N-[(1S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-enyl]-1-phenylmethanimine oxide |
| SMILES | C=CC[C@@H]([C@H]1COC(C)(C)O1)/[N+]([O-])=C/c1ccccc1 |
| InChI | InChI=1S/C16H21NO3/c1-4-8-14(15-12-19-16(2,3)20-15)17(18)11-13-9-6-5-7-10-13/h4-7,9-11,14-15H,1,8,12H2,2-3H3/b17-11-/t14-,15+/m0/s1 |
| InChIKey | UGOBFQOUYFNYBU-LVRDFQQOSA-N |
| XLogP | 2.71 |
| TPSA | 44.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|