C25H26ClFN4O2 — CID 166810163
5-amino-N-(3-chloro-4-fluorophenyl)-3-(5-hydroxy-4-phenyl-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl)-1-methylpyrazole-4-carboxamide (PubChem CID 166810163) has the molecular formula C25H26ClFN4O2 and a molecular weight of 468.96 g/mol. Its IUPAC name is 5-amino-N-(3-chloro-4-fluorophenyl)-3-(5-hydroxy-4-phenyl-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl)-1-methylpyrazole-4-carboxamide.
| Compound Name | 5-amino-N-(3-chloro-4-fluorophenyl)-3-(5-hydroxy-4-phenyl-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl)-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 166810163 |
| Molecular Formula | C25H26ClFN4O2 |
| Molecular Weight | 468.96 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 5-amino-N-(3-chloro-4-fluorophenyl)-3-(5-hydroxy-4-phenyl-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl)-1-methylpyrazole-4-carboxamide |
| SMILES | Cn1nc(C2CC3CC(O)C(c4ccccc4)C3C2)c(C(=O)Nc2ccc(F)c(Cl)c2)c1N |
| InChI | InChI=1S/C25H26ClFN4O2/c1-31-24(28)22(25(33)29-16-7-8-19(27)18(26)12-16)23(30-31)15-9-14-11-20(32)21(17(14)10-15)13-5-3-2-4-6-13/h2-8,12,14-15,17,20-21,32H,9-11,28H2,1H3,(H,29,33) |
| InChIKey | UMYAMTHDXSONQK-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.96 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |