C26H26ClF3N4O4S — CID 163875798
5-amino-3-[5-[benzenesulfonyl(difluoro)methyl]-5-hydroxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-N-(3-chloro-4-fluorophenyl)-1-methylpyrazole-4-carboxamide (PubChem CID 163875798) has the molecular formula C26H26ClF3N4O4S and a molecular weight of 583.03 g/mol. Its IUPAC name is 5-amino-3-[5-[benzenesulfonyl(difluoro)methyl]-5-hydroxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-N-(3-chloro-4-fluorophenyl)-1-methylpyrazole-4-carboxamide.
| Compound Name | 5-amino-3-[5-[benzenesulfonyl(difluoro)methyl]-5-hydroxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-N-(3-chloro-4-fluorophenyl)-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 163875798 |
| Molecular Formula | C26H26ClF3N4O4S |
| Molecular Weight | 583.03 g/mol |
| Exact Mass | 582.13 |
| IUPAC Name | 5-amino-3-[5-[benzenesulfonyl(difluoro)methyl]-5-hydroxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-N-(3-chloro-4-fluorophenyl)-1-methylpyrazole-4-carboxamide |
| SMILES | Cn1nc(C2CC3CC(O)(C(F)(F)S(=O)(=O)c4ccccc4)CC3C2)c(C(=O)Nc2ccc(F)c(Cl)c2)c1N |
| InChI | InChI=1S/C26H26ClF3N4O4S/c1-34-23(31)21(24(35)32-17-7-8-20(28)19(27)11-17)22(33-34)14-9-15-12-25(36,13-16(15)10-14)26(29,30)39(37,38)18-5-3-2-4-6-18/h2-8,11,14-16,36H,9-10,12-13,31H2,1H3,(H,32,35) |
| InChIKey | POSSOMCPMKKLOP-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.03 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |