C23H25ClFN7O4 — CID 166793591
3-[(3aS,6aR)-5-hydroxy-5-(1-methyl-3-nitropyrazol-5-yl)-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-5-amino-N-(3-chloro-4-fluorophenyl)-1-methylpyrazole-4-carboxamide (PubChem CID 166793591) has the molecular formula C23H25ClFN7O4 and a molecular weight of 517.95 g/mol. Its IUPAC name is 3-[(3aS,6aR)-5-hydroxy-5-(1-methyl-3-nitropyrazol-5-yl)-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-5-amino-N-(3-chloro-4-fluorophenyl)-1-methylpyrazole-4-carboxamide.
| Compound Name | 3-[(3aS,6aR)-5-hydroxy-5-(1-methyl-3-nitropyrazol-5-yl)-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-5-amino-N-(3-chloro-4-fluorophenyl)-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 166793591 |
| Molecular Formula | C23H25ClFN7O4 |
| Molecular Weight | 517.95 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | 3-[(3aS,6aR)-5-hydroxy-5-(1-methyl-3-nitropyrazol-5-yl)-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-5-amino-N-(3-chloro-4-fluorophenyl)-1-methylpyrazole-4-carboxamide |
| SMILES | Cn1nc([N+](=O)[O-])cc1C1(O)C[C@H]2CC(c3nn(C)c(N)c3C(=O)Nc3ccc(F)c(Cl)c3)C[C@H]2C1 |
| InChI | InChI=1S/C23H25ClFN7O4/c1-30-17(8-18(28-30)32(35)36)23(34)9-12-5-11(6-13(12)10-23)20-19(21(26)31(2)29-20)22(33)27-14-3-4-16(25)15(24)7-14/h3-4,7-8,11-13,34H,5-6,9-10,26H2,1-2H3,(H,27,33)/t11?,12-,13+,23? |
| InChIKey | JCOBERXSELNPTJ-RYLSVBLPSA-N |
| XLogP | 3.48 |
| TPSA | 154.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.95 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|