C18H18ClFN4O2 — CID 175410683
5-amino-N-(3-chloro-4-fluorophenyl)-3-(3-ethynyl-3-hydroxycyclopentyl)-1-methylpyrazole-4-carboxamide (PubChem CID 175410683) has the molecular formula C18H18ClFN4O2 and a molecular weight of 376.82 g/mol. Its IUPAC name is 5-amino-N-(3-chloro-4-fluorophenyl)-3-(3-ethynyl-3-hydroxycyclopentyl)-1-methylpyrazole-4-carboxamide.
| Compound Name | 5-amino-N-(3-chloro-4-fluorophenyl)-3-(3-ethynyl-3-hydroxycyclopentyl)-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 175410683 |
| Molecular Formula | C18H18ClFN4O2 |
| Molecular Weight | 376.82 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 5-amino-N-(3-chloro-4-fluorophenyl)-3-(3-ethynyl-3-hydroxycyclopentyl)-1-methylpyrazole-4-carboxamide |
| SMILES | C#CC1(O)CCC(c2nn(C)c(N)c2C(=O)Nc2ccc(F)c(Cl)c2)C1 |
| InChI | InChI=1S/C18H18ClFN4O2/c1-3-18(26)7-6-10(9-18)15-14(16(21)24(2)23-15)17(25)22-11-4-5-13(20)12(19)8-11/h1,4-5,8,10,26H,6-7,9,21H2,2H3,(H,22,25) |
| InChIKey | QPOWNDCCQHUWCP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.82 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|