C22H28ClFN4O3 — CID 167844725
3-[(2R,3aR)-4,5-dihydroxy-5-propan-2-yl-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-5-amino-N-(3-chloro-4-fluorophenyl)-1-methylpyrazole-4-carboxamide (PubChem CID 167844725) has the molecular formula C22H28ClFN4O3 and a molecular weight of 450.94 g/mol. Its IUPAC name is 3-[(2R,3aR)-4,5-dihydroxy-5-propan-2-yl-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-5-amino-N-(3-chloro-4-fluorophenyl)-1-methylpyrazole-4-carboxamide.
| Compound Name | 3-[(2R,3aR)-4,5-dihydroxy-5-propan-2-yl-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-5-amino-N-(3-chloro-4-fluorophenyl)-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 167844725 |
| Molecular Formula | C22H28ClFN4O3 |
| Molecular Weight | 450.94 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 3-[(2R,3aR)-4,5-dihydroxy-5-propan-2-yl-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-5-amino-N-(3-chloro-4-fluorophenyl)-1-methylpyrazole-4-carboxamide |
| SMILES | CC(C)C1(O)CC2C[C@@H](c3nn(C)c(N)c3C(=O)Nc3ccc(F)c(Cl)c3)C[C@H]2C1O |
| InChI | InChI=1S/C22H28ClFN4O3/c1-10(2)22(31)9-12-6-11(7-14(12)19(22)29)18-17(20(25)28(3)27-18)21(30)26-13-4-5-16(24)15(23)8-13/h4-5,8,10-12,14,19,29,31H,6-7,9,25H2,1-3H3,(H,26,30)/t11-,12?,14-,19?,22?/m1/s1 |
| InChIKey | TWYMUHMXYOADCF-GKZSOUEMSA-N |
| XLogP | 3.31 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.94 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |