C24H24ClF2N5O2 — CID 166810032
5-amino-N-(3-chloro-4-fluorophenyl)-3-[5-(5-fluoro-2-pyridinyl)-5-hydroxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-1-methylpyrazole-4-carboxamide (PubChem CID 166810032) has the molecular formula C24H24ClF2N5O2 and a molecular weight of 487.94 g/mol. Its IUPAC name is 5-amino-N-(3-chloro-4-fluorophenyl)-3-[5-(5-fluoro-2-pyridinyl)-5-hydroxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-1-methylpyrazole-4-carboxamide.
| Compound Name | 5-amino-N-(3-chloro-4-fluorophenyl)-3-[5-(5-fluoro-2-pyridinyl)-5-hydroxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 166810032 |
| Molecular Formula | C24H24ClF2N5O2 |
| Molecular Weight | 487.94 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | 5-amino-N-(3-chloro-4-fluorophenyl)-3-[5-(5-fluoro-2-pyridinyl)-5-hydroxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-1-methylpyrazole-4-carboxamide |
| SMILES | Cn1nc(C2CC3CC(O)(c4ccc(F)cn4)CC3C2)c(C(=O)Nc2ccc(F)c(Cl)c2)c1N |
| InChI | InChI=1S/C24H24ClF2N5O2/c1-32-22(28)20(23(33)30-16-3-4-18(27)17(25)8-16)21(31-32)12-6-13-9-24(34,10-14(13)7-12)19-5-2-15(26)11-29-19/h2-5,8,11-14,34H,6-7,9-10,28H2,1H3,(H,30,33) |
| InChIKey | JUZXSFSCCBEOJQ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 106.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.94 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |