C25H27ClFN5O2 — CID 166810036
5-amino-N-(3-chloro-4-fluorophenyl)-3-[5-hydroxy-5-(pyridin-2-ylmethyl)-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-1-methylpyrazole-4-carboxamide (PubChem CID 166810036) has the molecular formula C25H27ClFN5O2 and a molecular weight of 483.98 g/mol. Its IUPAC name is 5-amino-N-(3-chloro-4-fluorophenyl)-3-[5-hydroxy-5-(pyridin-2-ylmethyl)-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-1-methylpyrazole-4-carboxamide.
| Compound Name | 5-amino-N-(3-chloro-4-fluorophenyl)-3-[5-hydroxy-5-(pyridin-2-ylmethyl)-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 166810036 |
| Molecular Formula | C25H27ClFN5O2 |
| Molecular Weight | 483.98 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | 5-amino-N-(3-chloro-4-fluorophenyl)-3-[5-hydroxy-5-(pyridin-2-ylmethyl)-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-1-methylpyrazole-4-carboxamide |
| SMILES | Cn1nc(C2CC3CC(O)(Cc4ccccn4)CC3C2)c(C(=O)Nc2ccc(F)c(Cl)c2)c1N |
| InChI | InChI=1S/C25H27ClFN5O2/c1-32-23(28)21(24(33)30-17-5-6-20(27)19(26)10-17)22(31-32)14-8-15-11-25(34,12-16(15)9-14)13-18-4-2-3-7-29-18/h2-7,10,14-16,34H,8-9,11-13,28H2,1H3,(H,30,33) |
| InChIKey | JTPVDHIPVXAHTG-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 106.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.98 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |