C26H35ClFN5O3S — CID 167844742
3-[(3aR)-5-hydroxy-5-(2-morpholin-4-ylethylsulfanylmethyl)-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-5-amino-N-(3-chloro-4-fluorophenyl)-1-methylpyrazole-4-carboxamide (PubChem CID 167844742) has the molecular formula C26H35ClFN5O3S and a molecular weight of 552.12 g/mol. Its IUPAC name is 3-[(3aR)-5-hydroxy-5-(2-morpholin-4-ylethylsulfanylmethyl)-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-5-amino-N-(3-chloro-4-fluorophenyl)-1-methylpyrazole-4-carboxamide.
| Compound Name | 3-[(3aR)-5-hydroxy-5-(2-morpholin-4-ylethylsulfanylmethyl)-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-5-amino-N-(3-chloro-4-fluorophenyl)-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 167844742 |
| Molecular Formula | C26H35ClFN5O3S |
| Molecular Weight | 552.12 g/mol |
| Exact Mass | 551.21 |
| IUPAC Name | 3-[(3aR)-5-hydroxy-5-(2-morpholin-4-ylethylsulfanylmethyl)-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-5-amino-N-(3-chloro-4-fluorophenyl)-1-methylpyrazole-4-carboxamide |
| SMILES | Cn1nc(C2CC3CC(O)(CSCCN4CCOCC4)C[C@H]3C2)c(C(=O)Nc2ccc(F)c(Cl)c2)c1N |
| InChI | InChI=1S/C26H35ClFN5O3S/c1-32-24(29)22(25(34)30-19-2-3-21(28)20(27)12-19)23(31-32)16-10-17-13-26(35,14-18(17)11-16)15-37-9-6-33-4-7-36-8-5-33/h2-3,12,16-18,35H,4-11,13-15,29H2,1H3,(H,30,34)/t16?,17-,18?,26?/m1/s1 |
| InChIKey | OYFWEIZJGJYAGT-PBJOCHAJSA-N |
| XLogP | 3.75 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.12 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|