C22H29ClFN7O2 — CID 156897540
5-amino-3-[5-[(Z)-2-amino-1-[amino(methyl)amino]ethenyl]-5-hydroxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-N-(3-chloro-4-fluorophenyl)-1-methylpyrazole-4-carboxamide (PubChem CID 156897540) has the molecular formula C22H29ClFN7O2 and a molecular weight of 477.97 g/mol. Its IUPAC name is 5-amino-3-[5-[(Z)-2-amino-1-[amino(methyl)amino]ethenyl]-5-hydroxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-N-(3-chloro-4-fluorophenyl)-1-methylpyrazole-4-carboxamide.
| Compound Name | 5-amino-3-[5-[(Z)-2-amino-1-[amino(methyl)amino]ethenyl]-5-hydroxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-N-(3-chloro-4-fluorophenyl)-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 156897540 |
| Molecular Formula | C22H29ClFN7O2 |
| Molecular Weight | 477.97 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | 5-amino-3-[5-[(Z)-2-amino-1-[amino(methyl)amino]ethenyl]-5-hydroxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-N-(3-chloro-4-fluorophenyl)-1-methylpyrazole-4-carboxamide |
| SMILES | CN(N)/C(=C\N)C1(O)CC2CC(c3nn(C)c(N)c3C(=O)Nc3ccc(F)c(Cl)c3)CC2C1 |
| InChI | InChI=1S/C22H29ClFN7O2/c1-30(27)17(10-25)22(33)8-12-5-11(6-13(12)9-22)19-18(20(26)31(2)29-19)21(32)28-14-3-4-16(24)15(23)7-14/h3-4,7,10-13,33H,5-6,8-9,25-27H2,1-2H3,(H,28,32)/b17-10- |
| InChIKey | XZCDNSYTTFSGGD-YVLHZVERSA-N |
| XLogP | 2.29 |
| TPSA | 148.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.97 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|